BD0729332
((2R,3R)-3-(Benzoyloxy)-4,4-difluoro-5-((methylsulfonyl)oxy)tetrahydrofuran-2-yl)methyl benzoate , 98% , 122111-11-9
CAS NO.:122111-11-9
Empirical Formula: C20H18F2O8S
Molecular Weight: 456.41
MDL number: MFCD08460089
EINECS: 685-280-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB40.00 | In Stock |
|
| 1g | RMB97.60 | In Stock |
|
| 5g | RMB300.80 | In Stock |
|
| 10g | RMB504.80 | In Stock |
|
| 25g | RMB1014.40 | In Stock |
|
| 100g | RMB2543.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-74°C |
| Boiling point: | 588.4±50.0 °C(Predicted) |
| Density | 1.46±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol |
| form | Solid |
| color | Off-White to Pale Yellow |
| optical activity | 96.07°(C=0.01g/ml CHCL3) |
| InChI | InChI=1S/C20H18F2O8S/c1-31(25,26)30-19-20(21,22)16(29-18(24)14-10-6-3-7-11-14)15(28-19)12-27-17(23)13-8-4-2-5-9-13/h2-11,15-16,19H,12H2,1H3/t15-,16-,19/m1/s1 |
| InChIKey | LIAQHZDWFACWFK-QNRNLVPOSA-N |
| SMILES | C1(OS(C)(=O)=O)O[C@H](COC(=O)C2=CC=CC=C2)[C@@H](OC(=O)C2=CC=CC=C2)C1(F)F |
| CAS DataBase Reference | 122111-11-9(CAS DataBase Reference) |
Description and Uses
Gemcitabine intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |







