A3302612
3,5-Dichlorobenzonitrile , >98.0%(GC) , 6575-00-4
CAS NO.:6575-00-4
Empirical Formula: C7H3Cl2N
Molecular Weight: 172.01
MDL number: MFCD00001800
EINECS: 229-495-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB319.20 | In Stock |
|
| 500g | RMB1572.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-66 °C (lit.) |
| Boiling point: | 283.76°C (rough estimate) |
| Density | 1.4980 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol (Slightly) |
| form | Crystalline Powder |
| color | White to beige-brownish |
| BRN | 2207019 |
| InChI | InChI=1S/C7H3Cl2N/c8-6-1-5(4-10)2-7(9)3-6/h1-3H |
| InChIKey | PUJSUOGJGIECFQ-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(Cl)=CC(Cl)=C1 |
| CAS DataBase Reference | 6575-00-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Dichlorobenzonitrile(6575-00-4) |
Description and Uses
3,5-Dichlorobenzonitrile was used as internal standard during the programmed temperature vaporization-GC-MS determination of dichlobenil and 2,6-dichlorobenzamide in onions.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Warning |
| Hazard statements | H301+H311+H331-H302-H312-H331-H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P304+P340-P501a-P261-P280-P305+P351+P338-P264-P270-P271-P301+P310+P330-P302+P352+P312+P361+P364-P304+P340+P311-P305+P351+P338+P337+P313-P403+P233-P405-P501 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36/37/39-22-36-36/37-9 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Toxic |
| TSCA | N |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |





