A3302812
2,7-Dinitrofluorene , 98% , 5405-53-8
CAS NO.：5405-53-8
Empirical Formula: C13H8N2O4
Molecular Weight: 256.21
MDL number: MFCD00001121
EINECS: 226-457-8
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 330-334°C |
| Boiling point: | 399.45°C (rough estimate) |
| Density | 1.3298 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly) |
| form | Solid |
| color | Light Yellow |
| BRN | 2057852 |
| InChI | 1S/C13H8N2O4/c16-14(17)10-1-3-12-8(6-10)5-9-7-11(15(18)19)2-4-13(9)12/h1-4,6-7H,5H2 |
| InChIKey | IHZCVUBSTYOFSJ-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc-2c(Cc3cc(ccc-23)[N+]([O-])=O)c1 |
| CAS DataBase Reference | 5405-53-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 9H-fluorene, 2,7-dinitro-(5405-53-8) |
| EPA Substance Registry System | 9H-Fluorene, 2,7-dinitro- (5405-53-8) |
Description and Uses
2,7-Dinitrofluorene was used as a reagent in the synthesis of benzidine and diaminofluorene prolinamide derivatives which are potent hepatitis C virus NS5A inhibitors. Also used in the synthesis of symmetric anionic polymethine dyes derived from fluorene.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H351 |
| Precautionary statements | P281 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 40 |
| Safety Statements | 7-22-36/37/39-45-36 |
| WGK Germany | 3 |
| RTECS | LL7175000 |
| HS Code | 29042090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 |
