A3303212
2,6-Dichloropyridine-3-carbonitrile , 97% , 40381-90-6
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB23.20 | In Stock |
|
| 250MG | RMB33.60 | In Stock |
|
| 1G | RMB60.00 | In Stock |
|
| 5G | RMB214.40 | In Stock |
|
| 25g | RMB835.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 121-124 °C |
| Boiling point: | 286.0±35.0 °C(Predicted) |
| Density | 1.49±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -5.33±0.10(Predicted) |
| color | White to Light yellow |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C6H2Cl2N2/c7-5-2-1-4(3-9)6(8)10-5/h1-2H |
| InChIKey | LFCADBSUDWERJT-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC=C1C#N |
Description and Uses
2,6-Dichloro-3-cyanopyridine is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | T |
| Risk Statements | 25-41-37/38 |
| Safety Statements | 26-39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
