A3305412
N,N′-Dicyclohexylurea , 98% , 2387-23-7
Synonym(s):
N,N′-Dicyclohexylurea;1,3-Dicyclohexylurea;Lomustine Impurity C (PhEur)
CAS NO.：2387-23-7
Empirical Formula: C13H24N2O
Molecular Weight: 224.34
MDL number: MFCD00003829
EINECS: 219-213-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB102.40 | In Stock |
|
| 100G | RMB399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 232-233 °C(lit.) |
| Boiling point: | 408℃ |
| Density | 1.02 |
| refractive index | 1.4832 (estimate) |
| Flash point: | 158℃ |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly) |
| form | Liquid |
| pka | 13.89±0.20(Predicted) |
| color | Clear |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C13H24N2O/c16-13(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h11-12H,1-10H2,(H2,14,15,16) |
| InChIKey | ADFXKUOMJKEIND-UHFFFAOYSA-N |
| SMILES | N(C1CCCCC1)C(NC1CCCCC1)=O |
| CAS DataBase Reference | 2387-23-7(CAS DataBase Reference) |
| EPA Substance Registry System | N,N'-Dicyclohexylurea (2387-23-7) |
Description and Uses
N,N''-Dicyclohexylurea,is a substituted Urea (U822500) compound, which has shown to be a potent inhibitor of juvenile hormone epoxide hydrolase (JHEH) of the tobacco hornworm M. sexta. Lomustine USP Related Compound C.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-51/53 |
| Safety Statements | 61 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29242100 |
