A3306112
4,5-Difluoro-2-nitroaniline , >98.0%(GC) , 78056-39-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB56.00 | In Stock |
|
| 25G | RMB119.20 | In Stock |
|
| 100G | RMB439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107-108 °C (lit.) |
| Boiling point: | 308.1±37.0 °C(Predicted) |
| Density | 1.554±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| pka | -1.25±0.25(Predicted) |
| color | Golden to orange |
| BRN | 2723242 |
| InChI | InChI=1S/C6H4F2N2O2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H,9H2 |
| InChIKey | WDMCABATCGQAKK-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(F)=C(F)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 78056-39-0(CAS DataBase Reference) |
Description and Uses
4,5-Difluoro-2-nitroaniline has been used in the preparation of:
- 2-chloro-5,6-difluorobenzimidazole
- 1-(4,5-difluoro-2-nitrophenyl)pyrene via diazotization reaction with isoamyl nitrite in the presence of pyrene
- 5-ethoxy-6-fluorobenzofuroxan
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29214200 |
