A3306512
1,5-Dichloroanthraquinone , ≥96% , 82-46-2
CAS NO.:82-46-2
Empirical Formula: C14H6Cl2O2
Molecular Weight: 277.1
MDL number: MFCD00001190
EINECS: 201-424-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB46.40 | In Stock |
|
| 100G | RMB135.20 | In Stock |
|
| 250G | RMB279.20 | In Stock |
|
| 500G | RMB606.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 245-247 °C (lit.) |
| Boiling point: | 387.84°C (rough estimate) |
| Density | 1.3240 (rough estimate) |
| refractive index | 1.4730 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly, Heated, Sonicated), Ethyl Acetate (Slightly, Heated, Sonicated) |
| form | Solid |
| color | Light Yellow to Yellow |
| Water Solubility | Insoluble in water. |
| BRN | 402592 |
| InChI | InChI=1S/C14H6Cl2O2/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6H |
| InChIKey | MQIUMARJCOGCIM-UHFFFAOYSA-N |
| SMILES | C1(Cl)=C2C(C(=O)C3=C(C2=O)C=CC=C3Cl)=CC=C1 |
| CAS DataBase Reference | 82-46-2(CAS DataBase Reference) |
| EPA Substance Registry System | 9,10-Anthracenedione, 1,5-dichloro- (82-46-2) |
Description and Uses
1,5-Dichloroanthraquinone undergoes a solid-state transformation at 470 K. The two modifications are very similar, except that a is greater than b above the transition temperature and the inverse is at room temperature.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280i-P305+P351+P338-P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 24/25-26 |
| WGK Germany | 3 |
| RTECS | CB6495000 |
| TSCA | TSCA listed |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |







