A2450312
1-Chloroanthraquinone , ≥98.0% , 82-44-0
Synonym(s):
1-Chloroanthraquinone
CAS NO.:82-44-0
Empirical Formula: C14H7ClO2
Molecular Weight: 242.66
MDL number: MFCD00001189
EINECS: 201-421-4
| Pack Size | Price | Stock | Quantity |
| 100G | RMB127.20 | In Stock |
|
| 500G | RMB448.00 | In Stock |
|
| 2.5kg | RMB2229.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159-160 °C (lit.) |
| Boiling point: | 345.65°C (rough estimate) |
| Density | 1.2377 (rough estimate) |
| refractive index | 1.5380 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | Soluble in hot toluene. (almost transparency) |
| form | Powder or Chunks |
| color | Light yellow to yellow |
| BRN | 1912752 |
| InChI | InChI=1S/C14H7ClO2/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-7H |
| InChIKey | BOCJQSFSGAZAPQ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=C2C(C(=O)C3=C(C2=O)C=CC=C3)=CC=C1 |
| CAS DataBase Reference | 82-44-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 9,10-Anthracenedione, 1-chloro-(82-44-0) |
| EPA Substance Registry System | 1-Chloroanthraquinone (82-44-0) |
Description and Uses
1-Chloroanthraquinone is used to characterize anthraquinone intercalators as carrier molecules for second-generation platinum anticancer drugs.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H320-H412 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P273-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| RTECS | CB6150000 |
| TSCA | Yes |
| HS Code | 29147090 |
| Hazardous Substances Data | 82-44-0(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 15100 mg/kg |






