A3306612
2,6-Dichloropyridine-3-carboxylic acid , 98% , 38496-18-3
Synonym(s):
2,6-Dichloronicotinic acid
CAS NO.：38496-18-3
Empirical Formula: C6H3Cl2NO2
Molecular Weight: 192
MDL number: MFCD00075583
EINECS: 609-561-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB48.80 | In Stock |
|
| 25G | RMB185.60 | In Stock |
|
| 100g | RMB680.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-143 °C(lit.) |
| Boiling point: | 351.2±37.0 °C(Predicted) |
| Density | 1.612±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| pka | 1.77±0.28(Predicted) |
| form | Crystalline Powder |
| color | Off-white or pale yellow |
| BRN | 136114 |
| InChI | InChI=1S/C6H3Cl2NO2/c7-4-2-1-3(6(10)11)5(8)9-4/h1-2H,(H,10,11) |
| InChIKey | AJPKQSSFYHPYMH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC=C1C(O)=O |
| CAS DataBase Reference | 38496-18-3(CAS DataBase Reference) |
Description and Uses
Used for preparation of pyridine derivatives as inhibitors of human 11β hydroxysteroid dehydrogenase type 1 enzyme.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
