A3306912
2,4-Dibromopyridine , 97% , 58530-53-3
CAS NO.：58530-53-3
Empirical Formula: C5H3Br2N
Molecular Weight: 236.89
MDL number: MFCD01859720
EINECS: 663-373-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB30.40 | In Stock |
|
| 5G | RMB64.00 | In Stock |
|
| 25G | RMB212.80 | In Stock |
|
| 100G | RMB802.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 35-40 °C |
| Boiling point: | 238°C(lit.) |
| Density | 2.059±0.06 g/cm3(Predicted) |
| Flash point: | >110℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to lump to clear liquid |
| pka | 0.17±0.10(Predicted) |
| color | White or Colorless to Almost white or Almost colorless |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C5H3Br2N/c6-4-1-2-8-5(7)3-4/h1-3H |
| InChIKey | PCMMSLVJMKQWMQ-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC(Br)=C1 |
| CAS DataBase Reference | 58530-53-3(CAS DataBase Reference) |
Description and Uses
2,4-Dibromopyridine is a useful research chemical used in the synthesis of novel pyridine-bridged analogs of combretastatin-A4 as anticancer agents.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-22 |
| Safety Statements | 26-36/37/39-36-37-22 |
| RIDADR | 2811 |
| WGK Germany | 1 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 2933399990 |
