A3307512
1,2-Diaminoanthraquinone , ≥90% , 1758-68-5
CAS NO.:1758-68-5
Empirical Formula: C14H10N2O2
Molecular Weight: 238.24
MDL number: MFCD00001219
EINECS: 217-156-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB71.20 | In Stock |
|
| 25g | RMB198.40 | In Stock |
|
| 100g | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 289-291 °C (lit.) |
| Boiling point: | 380.84°C (rough estimate) |
| Density | 1.1907 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Solid |
| pka | 0.53±0.20(Predicted) |
| color | Brown to black |
| BRN | 2125604 |
| InChI | 1S/C14H10N2O2/c15-10-6-5-9-11(12(10)16)14(18)8-4-2-1-3-7(8)13(9)17/h1-6H,15-16H2 |
| InChIKey | LRMDXTVKVHKWEK-UHFFFAOYSA-N |
| SMILES | Nc1ccc2C(=O)c3ccccc3C(=O)c2c1N |
| CAS DataBase Reference | 1758-68-5(CAS DataBase Reference) |
| EPA Substance Registry System | 9,10-Anthracenedione, 1,2-diamino- (1758-68-5) |
Description and Uses
1,2-Diaminoanthraquinone is for the direct detection of nitric oxide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | CB6200000 |
| TSCA | TSCA listed |
| HS Code | 2921599090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![7,16-Dichlorodinaphtho[2,3-a:2',3'-h]phenazine-5,9,14,18(6H,15H)-tetraone](https://img.chemicalbook.com/CAS/GIF/130-20-1.gif)

