A3307812
3,5-Dibromoanisole , >98.0%(GC) , 74137-36-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB55.20 | In Stock |
|
| 25G | RMB192.00 | In Stock |
|
| 100g | RMB679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-38 °C |
| Boiling point: | 249.7°C |
| Density | 1.823 |
| Flash point: | 98.1°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Gray to Brown |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C7H6Br2O/c1-10-7-3-5(8)2-6(9)4-7/h2-4H,1H3 |
| InChIKey | OQZAQBGJENJMHT-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(OC)=CC(Br)=C1 |
| CAS DataBase Reference | 74137-36-3(CAS DataBase Reference) |
Description and Uses
3,5-Dibromoanisole, is an organic building block used for the synthesis of various pharmaceutical compounds, such as Dicationic m-Terphenyl and 1,3-Dipyridylbenzene Derivatives, having Antiprotozoal Activity.




