A3308112
Dimethyl 5-bromoisophthalate , 98%(GC) , 51760-21-5
Synonym(s):
Dimethyl 5-bromobenzene-1,3-dicarboxylate
CAS NO.：51760-21-5
Empirical Formula: C10H9BrO4
Molecular Weight: 273.08
MDL number: MFCD00078709
EINECS: 257-386-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB100.80 | In Stock |
|
| 25g | RMB394.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-89 °C |
| Boiling point: | 150 °C |
| Density | 1.505±0.06 g/cm3(Predicted) |
| Flash point: | 100 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Orange to Green |
| Water Solubility | Insoluble in water. |
| BRN | 2375428 |
| InChI | InChI=1S/C10H9BrO4/c1-14-9(12)6-3-7(10(13)15-2)5-8(11)4-6/h3-5H,1-2H3 |
| InChIKey | QUJINGKSNJNXEB-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=CC(Br)=CC(C(OC)=O)=C1 |
| CAS DataBase Reference | 51760-21-5(CAS DataBase Reference) |
| EPA Substance Registry System | Dimethyl 5-bromoisophthalate (51760-21-5) |
Description and Uses
Dimethyl 5-bromoisophthalate is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xi |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29173910 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
