A3310112
Desyl bromide , 97% , 1484-50-0
Synonym(s):
2-Bromo-2-phenylacetophenone
CAS NO.:1484-50-0
Empirical Formula: C14H11BrO
Molecular Weight: 275.14
MDL number: MFCD00000136
EINECS: 216-057-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB599.20 | In Stock |
|
| 25G | RMB2119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-58 °C (lit.) |
| Boiling point: | 344.8±22.0 °C(Predicted) |
| Density | 1.3930 (rough estimate) |
| refractive index | 1.5130 (estimate) |
| storage temp. | 0-6°C |
| solubility | soluble in Toluene |
| form | Crystalline Powder |
| color | Beige-brown |
| InChI | 1S/C14H11BrO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13H |
| InChIKey | ZFFBIQMNKOJDJE-UHFFFAOYSA-N |
| SMILES | BrC(c1ccccc1)C(=O)c2ccccc2 |
| CAS DataBase Reference | 1484-50-0(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanone, 2-bromo-1,2-diphenyl- (1484-50-0) |
Description and Uses
Desyl bromide has been used in:
- synthesis of phosphate esters of benzoin and benzoinyl N-carbobenzyloxyglycylphenylalanate
- novel chemiluminogenic reaction for the sensitive determination of Arg-containing peptides
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P271-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 28A-26-45-36/37/39-28-27 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







