A3320012
(S)-(-)-α,α-Diphenyl-2-pyrrolidinemethanol , ≥99.0% , 112068-01-6
Synonym(s):
(S)-(−)-2-(Diphenylhydroxymethyl)pyrrolidine;α,α-Diphenyl-L -prolinol
CAS NO.:112068-01-6
Empirical Formula: C17H19NO
Molecular Weight: 253.34
MDL number: MFCD00075506
EINECS: 601-153-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB64.00 | In Stock |
|
| 25G | RMB164.00 | In Stock |
|
| 100G | RMB540.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-80 °C(lit.) |
| alpha | -59 º (c=3, methanol 25 ºC) |
| Boiling point: | 396.54°C (rough estimate) |
| Density | 1.0078 (rough estimate) |
| refractive index | -66.5 ° (C=3, CHCl3) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in chloroform. |
| form | powder |
| pka | 13.15±0.29(Predicted) |
| color | white to off white ., crystal |
| optical activity | [α]20/D 67°, c = 3 in chloroform |
| Merck | 14,155 |
| BRN | 17103 |
| InChI | 1S/C17H19NO/c19-17(16-12-7-13-18-16,14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,16,18-19H,7,12-13H2/t16-/m0/s1 |
| InChIKey | OGCGXUGBDJGFFY-INIZCTEOSA-N |
| SMILES | OC([C@@H]1CCCN1)(c2ccccc2)c3ccccc3 |
| CAS DataBase Reference | 112068-01-6(CAS DataBase Reference) |
| NIST Chemistry Reference | S-(-)-1,1-diphenylprolinol(112068-01-6) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25-36 |
| WGK Germany | 3 |
| F | 10-34 |
| TSCA | No |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![1,1-DIPHENYL-TETRAHYDRO-PYRROLO[1,2-C]OXAZOL-3-ONE](https://img.chemicalbook.com/CAS/GIF/160424-29-3.gif)

![(S)-1,3,3-Triphenylhexahydropyrrolo[1,2-c][1,3,2]oxazaborole](https://img.chemicalbook.com/CAS/GIF/131180-90-0.gif)
![(S)-(+)-2-[Hydroxy(diphenyl)methyl]-1-methylpyrrolidine](https://img.chemicalbook.com/CAS/GIF/110529-22-1.gif)