A4747512
(S)-(+)-2-[Hydroxy(diphenyl)methyl]-1-methylpyrrolidine , 97% , 110529-22-1
Synonym(s):
(S)-α,α-Diphenyl-N-methyl-2-pyrrolidinemethanol
CAS NO.:110529-22-1
Empirical Formula: C18H21NO
Molecular Weight: 267.37
MDL number: MFCD00145245
EINECS: 634-571-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB69.60 | In Stock |
|
| 250MG | RMB81.60 | In Stock |
|
| 1G | RMB183.20 | In Stock |
|
| 5G | RMB606.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-72 °C |
| alpha | +52° (c=1, CHCl3) |
| Boiling point: | 406.8±25.0 °C(Predicted) |
| Density | 1.116±0.06 g/cm3(Predicted) |
| refractive index | 55 ° (C=1, CHCl3) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | sol hexane, benzene, toluene, Et2O, cyclohexane, dichloromethane |
| pka | 13.15±0.29(Predicted) |
| form | Powder |
| color | white to pale-yellow |
| optical activity | [α]20/D +55±3°, c = 1% in chloroform stab. with amylenes |
| BRN | 4749387 |
| InChI | 1S/C18H21NO/c1-19-14-8-13-17(19)18(20,15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2-7,9-12,17,20H,8,13-14H2,1H3/t17-/m0/s1 |
| InChIKey | XIJAGFLYYNXCAB-KRWDZBQOSA-N |
| SMILES | CN1CCC[C@H]1C(O)(c2ccccc2)c3ccccc3 |
| CAS DataBase Reference | 110529-22-1(CAS DataBase Reference) |
Description and Uses
(S)-(+)-2-[Hydroxy(diphenyl)methyl]-1-methylpyrrolidine is used for chiral ligand for the enantioselective addition of dialkylzincs, alkynylzinc, and cyanomethylzinc bromide to aldehydes; chiral ligand for the enantioselective Reformatsky reaction; chiral ligand for the enantioselective Diels-Alder reaction; chiral auxiliary for asymmetric polymerization.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-34 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![(S)-(+)-2-[Hydroxy(diphenyl)methyl]-1-methylpyrrolidine](https://img.chemicalbook.com/CAS/GIF/110529-22-1.gif)

![N-[(1S)-2''-aMino[1,1''-binaphthalen]-2-yl]-AcetaMide](https://img.chemicalbook.com/CAS/20150408/GIF/35216-74-1.gif)


