A3322212
Dichlorobis(triethylphosphine)palladium(II) , 97% , 28425-04-9
Synonym(s):
Bis(triethylphosphine)palladium dichloride
CAS NO.：28425-04-9
Empirical Formula: C12H30Cl2P2Pd
Molecular Weight: 413.64
MDL number: MFCD00191831
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB311.20 | In Stock |
|
| 1G | RMB1039.20 | In Stock |
|
| 5G | RMB3679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139-142 °C(lit.) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Soluble in chloroform, toluene and benzene |
| form | Powder |
| color | Yellow |
| Sensitive | Hygroscopic |
| InChI | 1S/2C6H15P.2ClH.Pd/c2*1-4-7(5-2)6-3;;;/h2*4-6H2,1-3H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | ULYNIEUXPCUIEL-UHFFFAOYSA-L |
| SMILES | Cl[Pd]Cl.CCP(CC)CC.CCP(CC)CC |
Description and Uses
trans-Dichlorobis(triethylphosphine)palladium(II) is used in coupling of C-C bonds. It is also used as pharmaceutical and organic Intermediates.
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H301-H311-H331 |
| Precautionary statements | P261-P305+P351+P338-P280-P301+P310a-P405-P501a |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN3464 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 28439090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
