A3360512
2,6-Dimethyl-3-nitropyridine , 97% , 15513-52-7
CAS NO.:15513-52-7
Empirical Formula: C7H8N2O2
Molecular Weight: 152.15
MDL number: MFCD00023503
EINECS: 239-543-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5G | RMB108.00 | In Stock |
|
| 25G | RMB412.80 | In Stock |
|
| 100g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 26-31 °C (lit.) |
| Boiling point: | 105°C/10mmHg(lit.) |
| Density | 1.45 |
| Flash point: | 100 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 2+-.0.10(Predicted) |
| color | Off-white to tan |
| InChI | 1S/C7H8N2O2/c1-5-3-4-7(9(10)11)6(2)8-5/h3-4H,1-2H3 |
| InChIKey | AETHUDGJSSKZKT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(c(C)n1)[N+]([O-])=O |
| CAS DataBase Reference | 15513-52-7(CAS DataBase Reference) |
Description and Uses
3-Nitro-2,6-lutidine may be used in the preparation of 3-methoxy-2,7-dimethyl-2H-1,4-diazepine1 and 3-amino-2,6-lutidine.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H228-H315-H319-H335 |
| Precautionary statements | P210-P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,Xi,Xn |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1325 4.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29333999 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Flam. Sol. 2 Skin Irrit. 2 STOT SE 3 |







