A3366512
2,5-Dichloro-1,4-phenylenediamine , ≥98.0% , 20103-09-7
Synonym(s):
1,4-Diamino-2,5-dichlorobenzene
CAS NO.:20103-09-7
Empirical Formula: C6H6Cl2N2
Molecular Weight: 177.03
MDL number: MFCD00007902
EINECS: 243-512-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB30.40 | In Stock |
|
| 5G | RMB92.00 | In Stock |
|
| 25G | RMB235.20 | In Stock |
|
| 100G | RMB878.40 | In Stock |
|
| 250g | RMB1512.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164-166 °C (dec.)(lit.) |
| Boiling point: | 291.88°C (rough estimate) |
| Density | 1.4668 (rough estimate) |
| refractive index | 1.6400 (estimate) |
| storage temp. | 2-8°C |
| pka | 3.16±0.10(Predicted) |
| form | powder to crystal |
| color | White to Brown |
| BRN | 2803055 |
| InChI | InChI=1S/C6H6Cl2N2/c7-3-1-5(9)4(8)2-6(3)10/h1-2H,9-10H2 |
| InChIKey | QAYVHDDEMLNVMO-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(Cl)=C(N)C=C1Cl |
| CAS DataBase Reference | 20103-09-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Benzenediamine, 2,5-dichloro- (20103-09-7) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| RTECS | SS9150000 |
| F | 9 |
| TSCA | TSCA listed |
| HS Code | 29215900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 20103-09-7(Hazardous Substances Data) |





