PRODUCT Properties
| Melting point: | 126-128°C (dec.) |
| alpha | D15 -7.95° (c = 10 in water) |
| Boiling point: | 314.29°C (rough estimate) |
| Density | 1.3243 (rough estimate) |
| refractive index | -7 ° (C=10, H2O) |
| Flash point: | 230℃ |
| storage temp. | Store at 0-5°C |
| solubility | Water (Slightly) |
| pka | 11.96±0.35(Predicted) |
| form | Solid |
| color | White to Pale Yellow |
| Merck | 14,4449 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C6H15NO5/c7-1-3(9)5(11)6(12)4(10)2-8/h3-6,8-12H,1-2,7H2/t3-,4+,5+,6+/m0/s1 |
| InChIKey | SDOFMBGMRVAJNF-SLPGGIOYSA-N |
| SMILES | C(N)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
| CAS DataBase Reference | 488-43-7(CAS DataBase Reference) |
Description and Uses
D-GLUCAMINE is a kind of useful ingredient for cosmetics, detergents and pharmaceutics.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 21-36/38-46-62-63 |
| Safety Statements | 25-26-36/37-53 |
| HS Code | 29400090 |
