PRODUCT Properties
| Melting point: | 33 °C |
| Boiling point: | 186 °C |
| Density | 1.131±0.06 g/cm3(Predicted) |
| refractive index | 1.49 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to lump to clear liquid |
| pka | 1.48±0.17(Predicted) |
| color | White or Colorless to Almost white or Almost colorless |
| InChI | InChI=1S/C6H8N2O2/c1-9-5-3-6(10-2)8-4-7-5/h3-4H,1-2H3 |
| InChIKey | FPSPPRZKBUVEJQ-UHFFFAOYSA-N |
| SMILES | C1=NC(OC)=CC(OC)=N1 |
| CAS DataBase Reference | 5270-94-0(CAS DataBase Reference) |
Description and Uses
4,6-dimethoxypyrimidine is a major active group that is commonly used as an intermediate in organic synthesis.
