A3372912
2,6-Dichlorophenylacetic Acid Methyl Ester , ≥98.0%(GC) , 54551-83-6
CAS NO.：54551-83-6
Empirical Formula: C9H8Cl2O2
Molecular Weight: 219.06
MDL number: MFCD00191640
EINECS: 259-221-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB271.20 | In Stock |
|
| 25G | RMB935.20 | In Stock |
|
| 100g | RMB2959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 314.25°C (rough estimate) |
| Density | 1.33 |
| refractive index | 1.54-1.542 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless |
| InChI | InChI=1S/C9H8Cl2O2/c1-13-9(12)5-6-7(10)3-2-4-8(6)11/h2-4H,5H2,1H3 |
| InChIKey | FCWRUYPZZJPCCG-UHFFFAOYSA-N |
| SMILES | C1(CC(OC)=O)=C(Cl)C=CC=C1Cl |
| CAS DataBase Reference | 54551-83-6 |
Description and Uses
Intermediate in the preparation of Guanfacine
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36/37/39-26 |
| HS Code | 29163100 |
