A3374712
3,5-Dichloronitrobenzene , ≥98.0%(GC) , 618-62-2
CAS NO.:618-62-2
Empirical Formula: C6H3Cl2NO2
Molecular Weight: 192
MDL number: MFCD00007211
EINECS: 210-557-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB91.20 | In Stock |
|
| 25G | RMB376.80 | In Stock |
|
| 100G | RMB783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-65 °C(lit.) |
| Boiling point: | 259.71°C (rough estimate) |
| Density | 1.4000 |
| vapor pressure | 1.5-101300Pa at 25-250℃ |
| refractive index | 1.4000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystals |
| color | Orange to brown |
| Water Solubility | insoluble |
| BRN | 2208877 |
| InChI | 1S/C6H3Cl2NO2/c7-4-1-5(8)3-6(2-4)9(10)11/h1-3H |
| InChIKey | RNABGKOKSBUFHW-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(Cl)cc(Cl)c1 |
| LogP | 3.09 at 25℃ |
| CAS DataBase Reference | 618-62-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Dichloronitrobenzene(618-62-2) |
| EPA Substance Registry System | Benzene, 1,3-dichloro-5-nitro- (618-62-2) |
Description and Uses
1,3-Dichloro-5-nitrobenzene was used as an internal standard in the 1H nuclear magnetic resonance spectroscopic method for the assay of phenylbutazone and oxyphenbutazone.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H319-H410 |
| Precautionary statements | P264-P270-P273-P280-P301+P312-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36/37-36/37/39-36 |
| RIDADR | UN3077 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29049095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





