A3376812
2,4-Dibromo-6-fluoroaniline , 97% , 141474-37-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB81.60 | In Stock |
|
| 25G | RMB230.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 59-64 °C(lit.) |
| Boiling point: | 245.7±35.0 °C(Predicted) |
| Density | 2.096±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 0.44±0.10(Predicted) |
| Appearance | Brown to reddish brown Solid |
| BRN | 6289292 |
| InChI | InChI=1S/C6H4Br2FN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
| InChIKey | YJLXEKFYZIBUPJ-UHFFFAOYSA-N |
| SMILES | C1(N)=C(F)C=C(Br)C=C1Br |
| CAS DataBase Reference | 141474-37-5(CAS DataBase Reference) |
Description and Uses
2,4-DIBROMO-6-FLUOROANILINE is used as pharmaceutical, pesticide, and liquid crystal material intermediates.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H331-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-36/37/39 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2921420090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






