A3380012
4,6-dichloro-5-nitropyrimidine , 97% , 4316-93-2
CAS NO.:4316-93-2
Empirical Formula: C4HCl2N3O2
Molecular Weight: 193.98
MDL number: MFCD00006107
EINECS: 224-340-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB73.60 | In Stock |
|
| 25G | RMB230.40 | In Stock |
|
| 100G | RMB784.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 100-103 °C (lit.) |
| Boiling point: | 325.8±37.0 °C(Predicted) |
| Density | 1.737±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform, Ethyl Acetate, Methanol, Toluene |
| form | Solid |
| pka | -7.48±0.26(Predicted) |
| color | White to Off-White |
| BRN | 162029 |
| InChI | InChI=1S/C4HCl2N3O2/c5-3-2(9(10)11)4(6)8-1-7-3/h1H |
| InChIKey | HCTISZQLTGAYOX-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=C([N+]([O-])=O)C(Cl)=N1 |
| CAS DataBase Reference | 4316-93-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyrimidine, 4,6-dichloro-5-nitro-(4316-93-2) |
| EPA Substance Registry System | Pyrimidine, 4,6-dichloro-5-nitro- (4316-93-2) |
Description and Uses
4,6-Dichloro-5-nitropyrimidine (cas# 4316-93-2) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-23/24/25 |
| Safety Statements | 26-36-45-36/37/39-7/9 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| RTECS | UV8258000 |
| TSCA | TSCA listed |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




