A3245312
2,4-Dichloro-5-nitropyrimidine , 97% , 49845-33-2
CAS NO.:49845-33-2
Empirical Formula: C4HCl2N3O2
Molecular Weight: 193.98
MDL number: MFCD00127867
EINECS: 629-447-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB62.40 | In Stock |
|
| 25G | RMB228.80 | In Stock |
|
| 100g | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 28-32 °C |
| Boiling point: | 0.9 °C0.5 mm Hg |
| Density | 2.0263 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid or Low Melting Solid |
| pka | -6.02±0.29(Predicted) |
| color | Clear yellow |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C4HCl2N3O2/c5-3-2(9(10)11)1-7-4(6)8-3/h1H |
| InChIKey | INUSQTPGSHFGHM-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C([N+]([O-])=O)C(Cl)=N1 |
| CAS DataBase Reference | 49845-33-2(CAS DataBase Reference) |
Description and Uses
Intermediate in a solid-phase synthesis of diaminopurines.1
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Moisture Sensitive/Keep under Argon |
| HazardClass | IRRITANT, LACHRYMATOR |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






