PRODUCT Properties
| Boiling point: | 139-140 °C/8 mmHg (lit.) |
| Density | 1.192 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform |
| form | Oil |
| pka | 12.60±0.20(Predicted) |
| color | Clear colourless to Pale Yellow |
| BRN | 1776666 |
| InChI | InChI=1S/C7H12O5/c1-11-6(9)3-5(8)4-7(10)12-2/h5,8H,3-4H2,1-2H3 |
| InChIKey | CUPGMRSSZADEIW-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)CC(O)CC(OC)=O |
| CAS DataBase Reference | 7250-55-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Glutaric acid, 3-hydroxy-, dimethyl ester(7250-55-7) |
Description and Uses
Dimethyl 3-hydroxyglutarate was used in the synthesis of two chiral fragments representing C1-11 and C12-25 of the polyene macrolide pimaricin.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| HS Code | 29181990 |
