A3381812
2-(3,4-Dichlorophenyl)ethanol , ≥96.0%(GC) , 35364-79-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB51.20 | In Stock |
|
| 5G | RMB168.80 | In Stock |
|
| 25G | RMB612.00 | In Stock |
|
| 100g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 165 °C / 14mmHg |
| Density | 1.32 |
| refractive index | 1.562-1.568 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Dichloromethane, Ethyl Acetate |
| form | Liquid |
| color | Clear colorless |
| InChI | InChI=1S/C8H8Cl2O/c9-7-2-1-6(3-4-11)5-8(7)10/h1-2,5,11H,3-4H2 |
| InChIKey | GITOMJDYNUMCOV-UHFFFAOYSA-N |
| SMILES | C1(CCO)=CC=C(Cl)C(Cl)=C1 |
Description and Uses
Intermediate in the synthesis of σ receptor ligands.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41-51-36/37/38-20/21/22 |
| Safety Statements | 24/25-39-26-36/37/39 |
| RIDADR | 2810 |
| HS Code | 29062990 |
