A3382012
4,5-Dimethyl-1,3-dioxol-2-one , ≥99.0%(GC) , 37830-90-3
CAS NO.：37830-90-3
Empirical Formula: C5H6O3
Molecular Weight: 114.1
MDL number: MFCD00135139
EINECS: 678-111-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 25G | RMB35.20 | In Stock |
|
| 100G | RMB81.60 | In Stock |
|
| 500g | RMB384.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78°C |
| Boiling point: | 130 °C / 6mmHg |
| Density | 1.181±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| form | Solid |
| color | White |
| InChI | InChI=1S/C5H6O3/c1-3-4(2)8-5(6)7-3/h1-2H3 |
| InChIKey | QYIOFABFKUOIBV-UHFFFAOYSA-N |
| SMILES | O1C(C)=C(C)OC1=O |
| CAS DataBase Reference | 37830-90-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3-Dioxol-2-one,4,5-dimethyl-(37830-90-3) |
Description and Uses
4,5-Dimethyl-1,3-dioxol-2-one is a dioxolanone derivative used in the preparation of synthetic chemotherapeutic antibiotics such as Prulifloxacin (P838885).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Risk Statements | 36/37/38-37-36 |
| Safety Statements | 26-36/37/39-36 |
| HS Code | 29329990 |
