A3382112
4,6-Dichloroquinoline , 97% , 4203-18-3
CAS NO.:4203-18-3
Empirical Formula: C9H5Cl2N
Molecular Weight: 198.05
MDL number: MFCD00156141
EINECS: 689-866-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB215.20 | In Stock |
|
| 1G | RMB508.80 | In Stock |
|
| 5G | RMB1511.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-105℃ |
| Boiling point: | 282.0±20.0 °C(Predicted) |
| Density | 1.407 |
| storage temp. | Storage temp. 2-8°C |
| pka | 2.76±0.16(Predicted) |
| form | powder to crystal |
| color | White to Gray to Brown |
| λmax | 318nm(EtOH aq.)(lit.) |
| InChI | InChI=1S/C9H5Cl2N/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-5H |
| InChIKey | JZGUMSTXLPEMFW-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(Cl)=CC=2)C(Cl)=CC=1 |
| CAS DataBase Reference | 4203-18-3 |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H318 |
| Precautionary statements | P280-P301+P310-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | 25-41 |
| Safety Statements | 26-39-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |







