A3384312
3,5-Dichlorobenzenesulfonyl Chloride , ≥98.0%(GC) , 705-21-5
CAS NO.:705-21-5
Empirical Formula: C6H3Cl3O2S
Molecular Weight: 245.51
MDL number: MFCD00051698
EINECS: 627-769-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB41.60 | In Stock |
|
| 5G | RMB110.40 | In Stock |
|
| 25G | RMB469.60 | In Stock |
|
| 100G | RMB1110.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 32-35 °C (lit.) |
| Boiling point: | 83-84°C 0,1mm |
| Density | 1.636±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to lump |
| color | White to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 1528657 |
| InChI | 1S/C6H3Cl3O2S/c7-4-1-5(8)3-6(2-4)12(9,10)11/h1-3H |
| InChIKey | RJSQINMKOSOUGT-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)cc(c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 705-21-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Moisture Sensitive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




