A3386212
1-Benzhydryl-3-azetidinone , 95% , 40320-60-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB42.40 | In Stock |
|
| 5G | RMB101.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75.0 to 79.0 °C |
| Boiling point: | 350-355℃ |
| Density | 1.182 |
| Flash point: | 156°(313°F) |
| refractive index | 1.626 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.10±0.20(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | InChI=1S/C16H15NO/c18-15-11-17(12-15)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,16H,11-12H2 |
| InChIKey | AVUDXLOVIBJFQA-UHFFFAOYSA-N |
| SMILES | N1(C(C2=CC=CC=C2)C2=CC=CC=C2)CC(=O)C1 |
Description and Uses
1-Benzhydrylazetidin-3-one is used in the synthesis of azetidine derivatives as novel γ-aminobutyric acid uptake inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Safety Statements | 24/25 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |






