A3389212
4’,5’-Dibromofluorescein , Dyecontent95% , 596-03-2
Synonym(s):
Solvent Red 72
CAS NO.:596-03-2
Empirical Formula: C20H10Br2O5
Molecular Weight: 490.1
MDL number: MFCD00005042
EINECS: 209-876-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB31.20 | In Stock |
|
| 25g | RMB119.20 | In Stock |
|
| 50G | RMB223.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270-273 °C(lit.) |
| Boiling point: | 633.7±55.0 °C(Predicted) |
| Density | 1.6743 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5010 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 8.14±0.20(Predicted) |
| Colour Index | 45370 |
| form | powder to crystal |
| color | Light yellow to Brown |
| Water Solubility | 153.49μg/L at 25℃ |
| λmax | 450 nm |
| ε(extinction coefficient) | ≥5000 at 445-451nm ≥50000 at 227-233nm |
| Merck | 14,3022 |
| BRN | 57189 |
| Major Application | diagnostic assay manufacturing hematology histology |
| Cosmetics Ingredients Functions | HAIR DYEING COLORANT |
| InChI | 1S/C20H10Br2O5/c21-15-13(23)7-5-11-17(15)26-18-12(6-8-14(24)16(18)22)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,23-24H |
| InChIKey | ZDTNHRWWURISAA-UHFFFAOYSA-N |
| SMILES | Oc1ccc2c(Oc3c(Br)c(O)ccc3C24OC(=O)c5ccccc45)c1Br |
| CAS DataBase Reference | 596-03-2(CAS DataBase Reference) |
| EPA Substance Registry System | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 4',5'-dibromo-3',6'-dihydroxy- (596-03-2) |
Description and Uses
4'',5''-Dibromofluorescein is a stain with an absorption maximum of 450 nm. Dyes and metabolites, Environmental Testing
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | Xi,T |
| Risk Statements | 36-25-36/37/38 |
| Safety Statements | 22-24/25-45-36-26 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | LM5200000 |
| TSCA | TSCA listed |
| HS Code | 32129000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |





