A3394712
3,5-dinitroaniline , ≥98.0%(GC) , 618-87-1
CAS NO.：618-87-1
Empirical Formula: C6H5N3O4
Molecular Weight: 183.12
MDL number: MFCD00007263
EINECS: 210-567-8
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160-162 °C(lit.) |
| Boiling point: | 316.77°C (rough estimate) |
| Density | 1.6010 |
| refractive index | 1.6910 (estimate) |
| storage temp. | room temp |
| Water Solubility | Practically insoluble in water |
| form | Powder |
| pka | pK1:0.229(+1) (25°C) |
| color | Yellow to brownish yellow |
| BRN | 648811 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C6H5N3O4/c7-4-1-5(8(10)11)3-6(2-4)9(12)13/h1-3H,7H2 |
| InChIKey | MPBZUKLDHPOCLS-UHFFFAOYSA-N |
| SMILES | Nc1cc(cc(c1)[N+]([O-])=O)[N+]([O-])=O |
| CAS DataBase Reference | 618-87-1(CAS DataBase Reference) |
| EPA Substance Registry System | 3,5-Dinitroaniline (618-87-1) |
Description and Uses
3,?5-?Dinitroaniline is an dye/stain. Dyes and metabolites.
Safety
| Symbol(GHS) |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H373-H411 |
| Precautionary statements | P262-P273-P280-P301+P310+P330-P302+P352+P310-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 23/24/25-33 |
| Safety Statements | 28-37-45 |
| RIDADR | UN 1596 6.1/PG 2 |
| WGK Germany | 2 |
| RTECS | BX9200100 |
| F | 8 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29214200 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 1 Inhalation Acute Tox. 2 Oral Aquatic Chronic 2 STOT RE 2 |
