A3395612
1,3-Dibenzoylbenzene , 98% , 3770-82-9
CAS NO.：3770-82-9
Empirical Formula: C20H14O2
Molecular Weight: 286.32
MDL number: MFCD00014086
EINECS: 223-210-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB184.00 | In Stock |
|
| 25G | RMB745.60 | In Stock |
|
| 100G | RMB2040.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-108 °C(lit.) |
| Boiling point: | 467.5±28.0 °C(Predicted) |
| Density | 1.165±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Sparingly Soluble (4.0E-3 g/L) (25°C). |
| form | solid |
| Appearance | Off-white to light yellow Solid |
| BRN | 1973337 |
| InChI | InChI=1S/C20H14O2/c21-19(15-8-3-1-4-9-15)17-12-7-13-18(14-17)20(22)16-10-5-2-6-11-16/h1-14H |
| InChIKey | MJQHDSIEDGPFAM-UHFFFAOYSA-N |
| SMILES | C1(C(C2=CC=CC=C2)=O)=CC=CC(C(C2=CC=CC=C2)=O)=C1 |
| CAS DataBase Reference | 3770-82-9(CAS DataBase Reference) |
| EPA Substance Registry System | Methanone, 1,3-phenylenebis[phenyl- (3770-82-9) |
Description and Uses
1,3-Dibenzoylbenzene is suitable reagent used in the synthesis of 1,3-bis(1-phenylvinyl)benzene (MDDPE). It may be used in the synthesis of polyanionic spin-quintet molecular clusters and ground state undecet hydrocarbon with 10 parallel spins.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| TSCA | Yes |
