A3395812
Difluoroacetic Anhydride , ≥95.0% , 401-67-2
CAS NO.：401-67-2
Empirical Formula: C4H2F4O3
Molecular Weight: 174.05
MDL number: MFCD02093315
EINECS: 200-258-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB109.60 | In Stock |
|
| 25G | RMB327.20 | In Stock |
|
| 100g | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 94℃ |
| Density | 1.4 |
| refractive index | 1.3410-1.3450 |
| Flash point: | 11℃ |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.59 |
| InChI | InChI=1S/C4H2F4O3/c5-1(6)3(9)11-4(10)2(7)8/h1-2H |
| InChIKey | QNRXDQIHPGZCFB-UHFFFAOYSA-N |
| SMILES | C(=O)(C(F)F)OC(=O)C(F)F |
| CAS DataBase Reference | 401-67-2 |
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H227-H290-H314 |
| Precautionary statements | P210-P234-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P403+P235-P405-P406-P501 |
| Hazard Codes | C |
| RIDADR | 3265 |
| HazardClass | CORROSIVE |
| PackingGroup | II |
| HS Code | 29189900 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
