A3399912
2,5-Diphenyl-1,4-benzoquinone , ≥99.0% , 844-51-9
CAS NO.:844-51-9
Empirical Formula: C18H12O2
Molecular Weight: 260.29
MDL number: MFCD00001600
EINECS: 212-680-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB127.20 | In Stock |
|
| 5G | RMB287.20 | In Stock |
|
| 25G | RMB742.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 215-217°C |
| Boiling point: | 457.9±45.0 °C(Predicted) |
| Density | 1.237±0.06 g/cm3(Predicted) |
| solubility | Soluble in hot Toluene (almost transparency). |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| BRN | 2051812 |
| Stability: | Stability |
| InChI | InChI=1S/C18H12O2/c19-17-12-16(14-9-5-2-6-10-14)18(20)11-15(17)13-7-3-1-4-8-13/h1-12H |
| InChIKey | QYXHDJJYVDLECA-UHFFFAOYSA-N |
| SMILES | C1(=O)C=C(C2=CC=CC=C2)C(=O)C=C1C1=CC=CC=C1 |
| CAS DataBase Reference | 844-51-9(CAS DataBase Reference) |
| EPA Substance Registry System | 2,5-Cyclohexadiene-1,4-dione, 2,5-diphenyl- (844-51-9) |
Description and Uses
2,5-Diphenyl-p-benzoquinone is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37 |
| TSCA | TSCA listed |
| HS Code | 2914.69.9000 |
| HazardClass | IRRITANT |





![[1,1'-Biphenyl]-2,5-dione](https://img.chemicalbook.com/CAS/GIF/363-03-1.gif)

