A3403412
Diethyl Propylmalonate , 98% , 2163-48-6
CAS NO.：2163-48-6
Empirical Formula: C10H18O4
Molecular Weight: 202.25
MDL number: MFCD00009168
EINECS: 218-492-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB73.60 | In Stock |
|
| 100G | RMB240.00 | In Stock |
|
| 500g | RMB1024.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 221-222 °C (lit.) |
| Density | 0.987 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 197 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Dichloromethane, Ethanol and Ethyl Acetate. |
| pka | 13.32±0.46(Predicted) |
| form | Oil |
| color | Clear Colourless |
| BRN | 510157 |
| InChI | InChI=1S/C10H18O4/c1-4-7-8(9(11)13-5-2)10(12)14-6-3/h8H,4-7H2,1-3H3 |
| InChIKey | GRRSDGHTSMJICM-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(CCC)C(OCC)=O |
| CAS DataBase Reference | 2163-48-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Diethyl propylmalonate(2163-48-6) |
Description and Uses
Diethyl propylmalonate was used in the synthesis of propylacrylic acid (PAA).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| Risk Statements | 10 |
| Safety Statements | 16-24/25-36/37/39-15/16 |
| WGK Germany | 3 |
| HS Code | 29171900 |
