A6976058
1,3-Acetonedicarboxylicacid , 10mMinDMSO , 542-05-2
Synonym(s):
ß-Ketoglutaric acid, Acetone-1,3-dicarboxylic acid;3-Oxoglutaric acid
CAS NO.:542-05-2
Empirical Formula: C5H6O5
Molecular Weight: 146.1
MDL number: MFCD00002711
EINECS: 208-797-9
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 133 °C (dec.) (lit.) |
| Boiling point: | 185.67°C (rough estimate) |
| Density | 1.2821 (rough estimate) |
| bulk density | 400kg/m3 |
| vapor pressure | 0.005Pa at 25℃ |
| refractive index | 1.3920 (estimate) |
| storage temp. | -20°C |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | pK (25°) 3.10 |
| color | White |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| Merck | 14,68 |
| BRN | 1447081 |
| Stability: | Unstable in Solution |
| InChI | 1S/C5H6O5/c6-3(1-4(7)8)2-5(9)10/h1-2H2,(H,7,8)(H,9,10)/p-2 |
| InChIKey | OXTNCQMOKLOUAM-UHFFFAOYSA-N |
| SMILES | [O-]C(=O)CC(=O)CC(=O)[O-] |
| LogP | -0.5 at 30℃ |
| CAS DataBase Reference | 542-05-2(CAS DataBase Reference) |
| EPA Substance Registry System | Pentanedioic acid, 3-oxo- (542-05-2) |
Description and Uses
β-Ketoglutaric Acid is used in the synthesis of benzodiazepine derivatives. Also used in the synthesis of orally available hepatitis C virus polymerase inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 44-36/37/38 |
| Safety Statements | 22-24/25-37/39-26-36 |
| WGK Germany | 3 |
| F | 3 |
| TSCA | TSCA listed |
| HS Code | 29183000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |







