A3404012
Diethyltrans-cyclopropane-1,2-dicarboxylate , 97% , 3999-55-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB55.20 | In Stock |
|
| 1g | RMB115.20 | In Stock |
|
| 5G | RMB341.60 | In Stock |
|
| 25g | RMB1574.40 | In Stock |
|
| 100g | RMB5224.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 70-75 °C/1 mmHg (lit.) |
| Density | 1.061 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 209 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid After Melting |
| color | Clear colorless to yellow |
| InChI | InChI=1/C9H14O4/c1-3-12-8(10)6-5-7(6)9(11)13-4-2/h6-7H,3-5H2,1-2H3/t6-,7-/s3 |
| InChIKey | SXLDHZFJMXLFJU-RNFRBKRXSA-N |
| SMILES | [C@@H]1(C(OCC)=O)C[C@H]1C(OCC)=O |&1:0,7,r| |
Description and Uses
Diethyl trans-1,2-cyclopropanedicarboxylate was obtained from the reaction of bis(acetonitrile)bis(diethyl fumarate)cobalt(0) with dibromomethane.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| PPE | Eyeshields, Gloves |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
| Storage Class | 10 - Combustible liquids |






