A3404312
Dimethylamine-d6 Hydrochloride , 99atom%D , 53170-19-7
Synonym(s):
Deuterated dimethylamine hydrochloride
CAS NO.:53170-19-7
Empirical Formula: C2H8ClN
Molecular Weight: 81.54
MDL number: MFCD00064544
EINECS: 258-409-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB623.20 | In Stock |
|
| 5G | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-173 °C(lit.) |
| solubility | DMSO (Sparingly), Methanol (Slightly), Water (Slightly) |
| form | solid |
| color | White to off-white |
| Sensitive | Hygroscopic |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C2H7N.ClH/c1-3-2;/h3H,1-2H3;1H/i1D3,2D3; |
| InChIKey | IQDGSYLLQPDQDV-TXHXQZCNSA-N |
| SMILES | N(C([2H])([2H])[2H])C([2H])([2H])[2H].Cl |
| CAS Number Unlabeled | 506-59-2 |
Description and Uses
Isotope labelled Dimethylamine hydrochloride is a precursor to several industrially significant compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 28459000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |






