A3404412
Dimethyl 4-Hydroxyisophthalate , ≥97.0%(GC) , 5985-24-0
Synonym(s):
Dimethyl 4-hydroxyisophthalate
CAS NO.:5985-24-0
Empirical Formula: C10H10O5
Molecular Weight: 210.18
MDL number: MFCD00152444
EINECS: 227-803-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB103.20 | In Stock |
|
| 1G | RMB259.20 | In Stock |
|
| 5G | RMB836.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 97 °C |
| Boiling point: | 305℃ |
| Density | 1.284 |
| Flash point: | 117℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly) |
| form | Solid |
| pka | 8.15±0.18(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical |
| InChI | 1S/C10H10O5/c1-14-9(12)6-3-4-8(11)7(5-6)10(13)15-2/h3-5,11H,1-2H3 |
| InChIKey | ALBUJVBOIXVVLS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(O)c(c1)C(=O)OC |
| EPA Substance Registry System | 1,3-Benzenedicarboxylic acid, 4-hydroxy-, dimethyl ester (5985-24-0) |
Description and Uses
4-Hydroxy-isophthalic Acid Dimethyl Ester (cas# 5985-24-0) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HS Code | 2918230000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





