A3406412
3,3-Diethoxy-1-propyne , ≥95.0%(GC) , 10160-87-9
Synonym(s):
Propargylaldehyde diethyl acetal;Propiolaldehyde diethyl acetal
CAS NO.：10160-87-9
Empirical Formula: C7H12O2
Molecular Weight: 128.17
MDL number: MFCD00009237
EINECS: 233-430-4
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB39.20 | In Stock |
|
| 5ML | RMB67.20 | In Stock |
|
| 25ML | RMB221.60 | In Stock |
|
| 100ML | RMB783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 138-139.5 °C(lit.) |
| Density | 0.894 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 90 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol (Slightly) |
| form | Liquid |
| Specific Gravity | 0.894 |
| color | Clear light yellow |
| Water Solubility | Slightly soluble in water. |
| BRN | 1701566 |
| Stability: | Light Sensitive, Volatile |
| InChI | InChI=1S/C7H12O2/c1-4-7(8-5-2)9-6-3/h1,7H,5-6H2,2-3H3 |
| InChIKey | RGUXEWWHSQGVRZ-UHFFFAOYSA-N |
| SMILES | C#CC(OCC)OCC |
| CAS DataBase Reference | 10160-87-9(CAS DataBase Reference) |
Description and Uses
Propargylaldehyde diethyl acetal is a useful reactant for the synthesis of alkenylsilanes via radical stereoselective hydrosilylation of alkynes with the help of Eosin Y and thiols as catalysts.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 21 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29110000 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
