A3407112
1,1-Diisopropoxycyclohexane , ≥95.0%(GC) , 1132-95-2
CAS NO.:1132-95-2
Empirical Formula: C12H24O2
Molecular Weight: 200.32
MDL number: MFCD00236381
EINECS: 413-740-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB41.60 | In Stock |
|
| 25G | RMB123.20 | In Stock |
|
| 100g | RMB358.40 | In Stock |
|
| 500g | RMB1264.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 85°C/8mmHg(lit.) |
| Density | 0.91 |
| refractive index | 1.4410 to 1.4450 |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C12H24O2/c1-10(2)13-12(14-11(3)4)8-6-5-7-9-12/h10-11H,5-9H2,1-4H3 |
| InChIKey | PLNTYOACSMHWBN-UHFFFAOYSA-N |
| SMILES | C1(OC(C)C)(OC(C)C)CCCCC1 |
| CAS DataBase Reference | 1132-95-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H227 |
| Precautionary statements | P501-P210-P264-P280-P370+P378-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P403+P235-P405 |
| RIDADR | UN 1760 8/PG II |
| HS Code | 2909.20.0000 |
| HazardClass | 8 |
| PackingGroup | II |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





