A3407312
1,3-Dichloro-5,5-dimethylhydantoin , ≥97% , 118-52-5
Synonym(s):
1,3-Dichloro-5,5-dimethyl-2,4-imidazolidinedione;DCDMH;NSC 33307;NSC 38630
CAS NO.:118-52-5
Empirical Formula: C5H6Cl2N2O2
Molecular Weight: 197.02
MDL number: MFCD00003190
EINECS: 204-258-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB24.00 | In Stock |
|
| 100G | RMB50.40 | In Stock |
|
| 500G | RMB128.80 | In Stock |
|
| 2.5KG | RMB488.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-134 °C (lit.) |
| Boiling point: | 214.7±23.0 °C(Predicted) |
| Density | 1,5 g/cm3 |
| vapor pressure | 0.003Pa |
| refractive index | 1.5720 (estimate) |
| Flash point: | 171 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | water: soluble0.21% at 25°C(lit.) |
| form | Crystalline Powder |
| pka | -3.44±0.40(Predicted) |
| color | White |
| PH | 4.4 (H2O)(HSDB) |
| Water Solubility | 0.21 g/100 mL (25 ºC) |
| Sensitive | Moisture Sensitive |
| Sublimation | 100 ºC |
| Merck | 14,3065 |
| BRN | 146013 |
| Exposure limits | NIOSH REL: TWA 0.2, STEL 0.4, IDLH 5; OSHA PEL: TWA 0.2,
STEL/C 0.4 (adopted). |
| Stability: | Stable, but a strong oxidizer - contact with combustible material may lead to fire. Incompatible with reducing agents, acids, strong bases. Moisture sensitive. |
| InChI | 1S/C5H6Cl2N2O2/c1-5(2)3(10)8(6)4(11)9(5)7/h1-2H3 |
| InChIKey | KEQGZUUPPQEDPF-UHFFFAOYSA-N |
| SMILES | CC1(C)N(Cl)C(=O)N(Cl)C1=O |
| LogP | -0.94 |
| CAS DataBase Reference | 118-52-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3-Dichloro-5,5-dimethylhydantoin (118-52-5) |
Description and Uses
DCDMH is a combustible, white powder witha chlorine-like odor. Molecular weight=197.03; Freezing/Melting point=130℃; Flash point=175℃. HazardIdentification (based on NFPA-704 M Rating System):Health 3, Flammability 1, Reactivity 0 Oxidizer, . Waterreactive; slightly soluble; solubility=0.2%.
Chlorinating agent; disinfectant; laundry bleach; in water treatment; intermediate for drugs; insecticides; polymerization catalyst
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS03,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H272-H302-H315-H317-H410 |
| Precautionary statements | P210-P220-P273-P280-P301+P312-P302+P352 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,C,O,N |
| Risk Statements | 22-36/37/38-34-8-50-43-31-20/21/22 |
| Safety Statements | 26-36-45-36/37/39-17-61 |
| RIDADR | UN 1479 5.1/PG 2 |
| OEB | C |
| OEL | TWA: 0.2 mg/m3, STEL: 0.4 mg/m3 |
| WGK Germany | 3 |
| RTECS | MU0700000 |
| TSCA | TSCA listed |
| HazardClass | 5.1 |
| PackingGroup | II |
| HS Code | 29332100 |
| Storage Class | 5.1B - Oxidizing hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Ox. Sol. 2 Skin Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 118-52-5(Hazardous Substances Data) |
| Toxicity | LD50 oral in rabbit: 1520mg/kg |
| IDLA | 5 mg/m3 |





![[3-(3,5-Dichlorophenyl)-2,4-dioxoimidazolidinyl]-N-(methylethyl)carboxamide](https://img.chemicalbook.com/CAS/GIF/36734-19-7.gif)
