A3408212
3,5-Dimethoxyphenylacetonitrile , ≥98% , 13388-75-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB128.80 | In Stock |
|
| 25g | RMB572.00 | In Stock |
|
| 100g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54-57 °C(lit.) |
| Boiling point: | 316.7±27.0 °C(Predicted) |
| Density | 1.082±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Dichloromethane, Ethyl Acetate |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 2096481 |
| InChI | InChI=1S/C10H11NO2/c1-12-9-5-8(3-4-11)6-10(7-9)13-2/h5-7H,3H2,1-2H3 |
| InChIKey | UUNRWZQWCNTSCV-UHFFFAOYSA-N |
| SMILES | C1(CC#N)=CC(OC)=CC(OC)=C1 |
| CAS DataBase Reference | 13388-75-5(CAS DataBase Reference) |
Description and Uses
(3,5-Dimethoxyphenyl)acetonitrile (cas# 13388-75-5) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312 |
| Precautionary statements | P280h |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,T |
| Risk Statements | 22 |
| Safety Statements | 36/37-24/25 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
