A3412012
3,3-Dimethylcyclohexanone , >97.0%(GC) , 2979-19-3
CAS NO.:2979-19-3
Empirical Formula: C8H14O
Molecular Weight: 126.2
MDL number: MFCD00040178
EINECS: 628-905-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB53.60 | In Stock |
|
| 10G | RMB95.20 | In Stock |
|
| 25G | RMB167.20 | In Stock |
|
| 50G | RMB239.20 | In Stock |
|
| 100G | RMB468.80 | In Stock |
|
| 500g | RMB2159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 9.25°C (estimate) |
| Boiling point: | 174-175 °C (lit.) |
| Density | 0.909 g/mL at 25 °C (lit.) |
| refractive index | n20/D 1.449(lit.) |
| Flash point: | 175°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C8H14O/c1-8(2)5-3-4-7(9)6-8/h3-6H2,1-2H3 |
| InChIKey | ZVJQBBYAVPAFLX-UHFFFAOYSA-N |
| SMILES | C1(=O)CCCC(C)(C)C1 |
| EPA Substance Registry System | Cyclohexanone, 3,3-dimethyl- (2979-19-3) |
Description and Uses
An interest in the boll weevil sex attractants prompted an investigation into alternative syntheses of the starting material, 3, 3-dimethylcyclohexanone.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 41-36-10 |
| Safety Statements | 26-38 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29142990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 |






