A3414912
3,5-Dibromobenzyl Bromide , ≥98% , 56908-88-4
CAS NO.:56908-88-4
Empirical Formula: C7H5Br3
Molecular Weight: 328.83
MDL number: MFCD00052415
EINECS: 679-472-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.80 | In Stock |
|
| 5G | RMB99.20 | In Stock |
|
| 25G | RMB323.20 | In Stock |
|
| 100g | RMB1071.20 | In Stock |
|
| 500g | RMB3975.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-97 °C |
| Boiling point: | 276.85°C (rough estimate) |
| Density | 2.1881 (estimate) |
| refractive index | 1.6340 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in toluene |
| form | Powder |
| color | White to beige-brownish |
| BRN | 3237827 |
| InChI | InChI=1S/C7H5Br3/c8-4-5-1-6(9)3-7(10)2-5/h1-3H,4H2 |
| InChIKey | PWTFRUXTAFBWBW-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(CBr)=CC(Br)=C1 |
| CAS DataBase Reference | 56908-88-4(CAS DataBase Reference) |
Description and Uses
3,5-Dibromobenzyl bromide, is an important raw material and intermediateintermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P501a-P234-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501 |
| Hazard Codes | C-F,C,F |
| Risk Statements | 34-11 |
| Safety Statements | 45-36/37/39-26 |
| RIDADR | 1759 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






