A3418412
(3,4-Dimethoxyphenyl)acetone , ≥97% , 776-99-8
CAS NO.:776-99-8
Empirical Formula: C11H14O3
Molecular Weight: 194.23
MDL number: MFCD00008772
EINECS: 212-285-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10G | RMB28.80 | In Stock |
|
| 25G | RMB60.80 | In Stock |
|
| 50G | RMB143.20 | In Stock |
|
| 100G | RMB190.40 | In Stock |
|
| 250G | RMB313.60 | In Stock |
|
| 500G | RMB720.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-139 °C |
| Boiling point: | 154-158 °C (12 mmHg) |
| Density | 1.115 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| Water Solubility | Insoluble in water. |
| BRN | 1107410 |
| InChI | InChI=1S/C11H14O3/c1-8(12)6-9-4-5-10(13-2)11(7-9)14-3/h4-5,7H,6H2,1-3H3 |
| InChIKey | UMYZWICEDUEWIM-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(OC)C(OC)=C1)C(=O)C |
| CAS DataBase Reference | 776-99-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,4-Dimethoxyphenylacetone(776-99-8) |
Description and Uses
3,4-Dimethoxyphenylacetone was used as starting material in the synthesis of α-methyl-dopa, an important nonproteogenic α-amino acid for pharmaceutical applications. 3,4-Dimethoxyphenylacetone undergoes asymmetric amination catalyzed by Brevibacterium linens IFO 12141 strain to yield corresponding optically active amine
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | UC1795500 |
| HS Code | 29145090 |





