A3424612
2,6-Dichloro-7-deazapurine , >98.0%(HPLC) , 90213-66-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB44.00 | In Stock |
|
| 5G | RMB64.00 | In Stock |
|
| 25g | RMB246.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 247-250°C |
| Boiling point: | 312.0±52.0 °C(Predicted) |
| Density | 1.79±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Acetone (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.18±0.20(Predicted) |
| color | Off-White to Yellow |
| Water Solubility | Soluble in DMSO, ethyl acetate and methanol. Slightly soluble in water. |
| InChI | InChI=1S/C6H3Cl2N3/c7-4-3-1-2-9-5(3)11-6(8)10-4/h1-2H,(H,9,10,11) |
| InChIKey | GHXBPCSSQOKKGB-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=C2C=CNC2=N1 |
Description and Uses
It is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | T |
| Risk Statements | 25-36-36/37/38-22 |
| Safety Statements | 26-45-28-36 |
| RIDADR | UN2811 |
| HazardClass | IRRITANT |
| HS Code | 29335990 |





![5-Bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine](https://img.chemicalbook.com/CAS/GIF/22276-95-5.gif)
![4-Aminopyrazolo[3,4-<i>d</i>]pyrimidine](https://img.chemicalbook.com/CAS/GIF/2380-63-4.gif)
![4-Chloro-7-tosyl-7H-pyrrolo[2,3-d]pyrimidine](https://img.chemicalbook.com/CAS/GIF/479633-63-1.gif)